C21H22N2O5S — CID 177378942
1-O-tert-butyl 1-O'-methyl (1R,2R,5R)-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate (PubChem CID 177378942) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is 1-O-tert-butyl 1-O'-methyl (1R,2R,5R)-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate.
| Compound Name | 1-O-tert-butyl 1-O'-methyl (1R,2R,5R)-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 177378942 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-O-tert-butyl 1-O'-methyl (1R,2R,5R)-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
| SMILES | COC(=O)N1C(=O)[C@@]2(C=C[C@H](N=C=S)C[C@H]2C(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H22N2O5S/c1-20(2,3)28-17(24)15-11-13(22-12-29)9-10-21(15)14-7-5-6-8-16(14)23(18(21)25)19(26)27-4/h5-10,13,15H,11H2,1-4H3/t13-,15-,21-/m0/s1 |
| InChIKey | VLCCAYPVZWZEET-YHQOMNDMSA-N |
| XLogP | 3.43 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|