C29H30N2O5S — CID 177378943
1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-5-isothiocyanato-4,5-dimethyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate (PubChem CID 177378943) has the molecular formula C29H30N2O5S and a molecular weight of 518.64 g/mol. Its IUPAC name is 1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-5-isothiocyanato-4,5-dimethyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate.
| Compound Name | 1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-5-isothiocyanato-4,5-dimethyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 177378943 |
| Molecular Formula | C29H30N2O5S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-5-isothiocyanato-4,5-dimethyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
| SMILES | CC1=C[C@@]2(C(=O)N(C(=O)OCc3ccccc3)c3ccccc32)[C@H](C(=O)OC(C)(C)C)C[C@@]1(C)N=C=S |
| InChI | InChI=1S/C29H30N2O5S/c1-19-15-29(22(16-28(19,5)30-18-37)24(32)36-27(2,3)4)21-13-9-10-14-23(21)31(25(29)33)26(34)35-17-20-11-7-6-8-12-20/h6-15,22H,16-17H2,1-5H3/t22-,28+,29-/m0/s1 |
| InChIKey | FDVXSIXEQDAVPA-GJDOKZOISA-N |
| XLogP | 5.78 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|