C31H34N2O5S — CID 177378944
1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-4,5-diethyl-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate (PubChem CID 177378944) has the molecular formula C31H34N2O5S and a molecular weight of 546.69 g/mol. Its IUPAC name is 1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-4,5-diethyl-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate.
| Compound Name | 1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-4,5-diethyl-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 177378944 |
| Molecular Formula | C31H34N2O5S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-4,5-diethyl-5-isothiocyanato-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
| SMILES | CCC1=C[C@@]2(C(=O)N(C(=O)OCc3ccccc3)c3ccccc32)[C@H](C(=O)OC(C)(C)C)C[C@@]1(CC)N=C=S |
| InChI | InChI=1S/C31H34N2O5S/c1-6-22-17-31(24(26(34)38-29(3,4)5)18-30(22,7-2)32-20-39)23-15-11-12-16-25(23)33(27(31)35)28(36)37-19-21-13-9-8-10-14-21/h8-17,24H,6-7,18-19H2,1-5H3/t24-,30+,31-/m0/s1 |
| InChIKey | QUCWBJAIFLMACN-IFDYJGHISA-N |
| XLogP | 6.56 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|