C28H28N2O5S — CID 177378945
1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-5-isothiocyanato-4-methyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate (PubChem CID 177378945) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is 1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-5-isothiocyanato-4-methyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate.
| Compound Name | 1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-5-isothiocyanato-4-methyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
|---|---|
| PubChem CID | 177378945 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 1-O'-benzyl 1-O-tert-butyl (1R,2R,5R)-5-isothiocyanato-4-methyl-2'-oxospiro[cyclohex-3-ene-2,3'-indole]-1,1'-dicarboxylate |
| SMILES | CC1=C[C@@]2(C(=O)N(C(=O)OCc3ccccc3)c3ccccc32)[C@H](C(=O)OC(C)(C)C)C[C@H]1N=C=S |
| InChI | InChI=1S/C28H28N2O5S/c1-18-15-28(21(14-22(18)29-17-36)24(31)35-27(2,3)4)20-12-8-9-13-23(20)30(25(28)32)26(33)34-16-19-10-6-5-7-11-19/h5-13,15,21-22H,14,16H2,1-4H3/t21-,22+,28-/m0/s1 |
| InChIKey | BENFKCCOSTXCAJ-TYPXCFOJSA-N |
| XLogP | 5.39 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|