C18H22N6O4 — CID 177378960
1-[5-(5,6-dimethoxy-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-2-yl]-3-(2-ethoxyethyl)urea (PubChem CID 177378960) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 1-[5-(5,6-dimethoxy-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-2-yl]-3-(2-ethoxyethyl)urea.
| Compound Name | 1-[5-(5,6-dimethoxy-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-2-yl]-3-(2-ethoxyethyl)urea |
|---|---|
| PubChem CID | 177378960 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[5-(5,6-dimethoxy-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-2-yl]-3-(2-ethoxyethyl)urea |
| SMILES | CCOCCNC(=O)Nc1cc2nc(-c3cnc(OC)c(OC)c3)ccn2n1 |
| InChI | InChI=1S/C18H22N6O4/c1-4-28-8-6-19-18(25)22-15-10-16-21-13(5-7-24(16)23-15)12-9-14(26-2)17(27-3)20-11-12/h5,7,9-11H,4,6,8H2,1-3H3,(H2,19,22,23,25) |
| InChIKey | HTSSZLURDMBMPC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|