C27H28F2N6O5S — CID 177378973
6-(4-cyclopropyl-2-fluoroanilino)-7-fluoro-N-(2-hydroxyethoxy)-3-[[3-(methylsulfamoylamino)phenyl]methyl]benzimidazole-5-carboxamide (PubChem CID 177378973) has the molecular formula C27H28F2N6O5S and a molecular weight of 586.62 g/mol. Its IUPAC name is 6-(4-cyclopropyl-2-fluoroanilino)-7-fluoro-N-(2-hydroxyethoxy)-3-[[3-(methylsulfamoylamino)phenyl]methyl]benzimidazole-5-carboxamide.
| Compound Name | 6-(4-cyclopropyl-2-fluoroanilino)-7-fluoro-N-(2-hydroxyethoxy)-3-[[3-(methylsulfamoylamino)phenyl]methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 177378973 |
| Molecular Formula | C27H28F2N6O5S |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 6-(4-cyclopropyl-2-fluoroanilino)-7-fluoro-N-(2-hydroxyethoxy)-3-[[3-(methylsulfamoylamino)phenyl]methyl]benzimidazole-5-carboxamide |
| SMILES | CNS(=O)(=O)Nc1cccc(Cn2cnc3c(F)c(Nc4ccc(C5CC5)cc4F)c(C(=O)NOCCO)cc32)c1 |
| InChI | InChI=1S/C27H28F2N6O5S/c1-30-41(38,39)34-19-4-2-3-16(11-19)14-35-15-31-26-23(35)13-20(27(37)33-40-10-9-36)25(24(26)29)32-22-8-7-18(12-21(22)28)17-5-6-17/h2-4,7-8,11-13,15,17,30,32,34,36H,5-6,9-10,14H2,1H3,(H,33,37) |
| InChIKey | QJIMCCPZACTFFG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|