C28H30F2N6O5S — CID 177378975
6-(4-cyclopropyl-2-fluoroanilino)-3-[[3-(ethylsulfamoylamino)phenyl]methyl]-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide (PubChem CID 177378975) has the molecular formula C28H30F2N6O5S and a molecular weight of 600.65 g/mol. Its IUPAC name is 6-(4-cyclopropyl-2-fluoroanilino)-3-[[3-(ethylsulfamoylamino)phenyl]methyl]-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide.
| Compound Name | 6-(4-cyclopropyl-2-fluoroanilino)-3-[[3-(ethylsulfamoylamino)phenyl]methyl]-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 177378975 |
| Molecular Formula | C28H30F2N6O5S |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 6-(4-cyclopropyl-2-fluoroanilino)-3-[[3-(ethylsulfamoylamino)phenyl]methyl]-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide |
| SMILES | CCNS(=O)(=O)Nc1cccc(Cn2cnc3c(F)c(Nc4ccc(C5CC5)cc4F)c(C(=O)NOCCO)cc32)c1 |
| InChI | InChI=1S/C28H30F2N6O5S/c1-2-32-42(39,40)35-20-5-3-4-17(12-20)15-36-16-31-27-24(36)14-21(28(38)34-41-11-10-37)26(25(27)30)33-23-9-8-19(13-22(23)29)18-6-7-18/h3-5,8-9,12-14,16,18,32-33,35,37H,2,6-7,10-11,15H2,1H3,(H,34,38) |
| InChIKey | MKJZZWHJRSYFCN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|