C28H29F3N6O5S — CID 177378977
6-(4-cyclopropyl-2-fluoroanilino)-3-[[3-(ethylsulfamoylamino)-2-fluorophenyl]methyl]-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide (PubChem CID 177378977) has the molecular formula C28H29F3N6O5S and a molecular weight of 618.64 g/mol. Its IUPAC name is 6-(4-cyclopropyl-2-fluoroanilino)-3-[[3-(ethylsulfamoylamino)-2-fluorophenyl]methyl]-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide.
| Compound Name | 6-(4-cyclopropyl-2-fluoroanilino)-3-[[3-(ethylsulfamoylamino)-2-fluorophenyl]methyl]-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 177378977 |
| Molecular Formula | C28H29F3N6O5S |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | 6-(4-cyclopropyl-2-fluoroanilino)-3-[[3-(ethylsulfamoylamino)-2-fluorophenyl]methyl]-7-fluoro-N-(2-hydroxyethoxy)benzimidazole-5-carboxamide |
| SMILES | CCNS(=O)(=O)Nc1cccc(Cn2cnc3c(F)c(Nc4ccc(C5CC5)cc4F)c(C(=O)NOCCO)cc32)c1F |
| InChI | InChI=1S/C28H29F3N6O5S/c1-2-33-43(40,41)36-22-5-3-4-18(24(22)30)14-37-15-32-27-23(37)13-19(28(39)35-42-11-10-38)26(25(27)31)34-21-9-8-17(12-20(21)29)16-6-7-16/h3-5,8-9,12-13,15-16,33-34,36,38H,2,6-7,10-11,14H2,1H3,(H,35,39) |
| InChIKey | RRIRRMNYRKMFLD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 146.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|