C16H15ClN6O3S — CID 177379251
4-[[[4-chloro-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]methyl]benzenesulfonamide (PubChem CID 177379251) has the molecular formula C16H15ClN6O3S and a molecular weight of 406.86 g/mol. Its IUPAC name is 4-[[[4-chloro-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[4-chloro-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 177379251 |
| Molecular Formula | C16H15ClN6O3S |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 4-[[[4-chloro-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNc2nc(Cl)nc(Nc3ccc(O)cc3)n2)cc1 |
| InChI | InChI=1S/C16H15ClN6O3S/c17-14-21-15(19-9-10-1-7-13(8-2-10)27(18,25)26)23-16(22-14)20-11-3-5-12(24)6-4-11/h1-8,24H,9H2,(H2,18,25,26)(H2,19,20,21,22,23) |
| InChIKey | IFRQFKKVGZRIBZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|