C32H29F3N6O4S2 — CID 177379664
7-[[4-[4-[3-[(2,6-difluorophenyl)sulfonylamino]-2-fluorophenyl]-2-phenyl-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]-N-hydroxyheptanamide (PubChem CID 177379664) has the molecular formula C32H29F3N6O4S2 and a molecular weight of 682.75 g/mol. Its IUPAC name is 7-[[4-[4-[3-[(2,6-difluorophenyl)sulfonylamino]-2-fluorophenyl]-2-phenyl-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]-N-hydroxyheptanamide.
| Compound Name | 7-[[4-[4-[3-[(2,6-difluorophenyl)sulfonylamino]-2-fluorophenyl]-2-phenyl-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 177379664 |
| Molecular Formula | C32H29F3N6O4S2 |
| Molecular Weight | 682.75 g/mol |
| Exact Mass | 682.16 |
| IUPAC Name | 7-[[4-[4-[3-[(2,6-difluorophenyl)sulfonylamino]-2-fluorophenyl]-2-phenyl-1,3-thiazol-5-yl]pyrimidin-2-yl]amino]-N-hydroxyheptanamide |
| SMILES | O=C(CCCCCCNc1nccc(-c2sc(-c3ccccc3)nc2-c2cccc(NS(=O)(=O)c3c(F)cccc3F)c2F)n1)NO |
| InChI | InChI=1S/C32H29F3N6O4S2/c33-22-13-9-14-23(34)30(22)47(44,45)41-24-15-8-12-21(27(24)35)28-29(46-31(39-28)20-10-4-3-5-11-20)25-17-19-37-32(38-25)36-18-7-2-1-6-16-26(42)40-43/h3-5,8-15,17,19,41,43H,1-2,6-7,16,18H2,(H,40,42)(H,36,37,38) |
| InChIKey | ZBUVKZFJRCJJKF-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.75 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|