About 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide
5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide (PubChem CID 177379740) has the molecular formula C22H23N5O2S
and a molecular weight of 421.53 g/mol. Its IUPAC name is 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide |
| PubChem CID | 177379740 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide |
| SMILES | NC(=O)c1cc2cc(N3CCN(CCc4ccc5nc(N)sc5c4)CC3)ccc2o1 |
| InChI | InChI=1S/C22H23N5O2S/c23-21(28)19-13-15-12-16(2-4-18(15)29-19)27-9-7-26(8-10-27)6-5-14-1-3-17-20(11-14)30-22(24)25-17/h1-4,11-13H,5-10H2,(H2,23,28)(H2,24,25) |
| InChIKey | SRLOZBIANMLHLV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide?
The IUPAC name of 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide (CID 177379740) is 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide.
What is the SMILES notation for 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide?
The canonical SMILES for 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide is NC(=O)c1cc2cc(N3CCN(CCc4ccc5nc(N)sc5c4)CC3)ccc2o1.
What is the InChIKey of 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide?
The InChIKey is SRLOZBIANMLHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5O2S/c23-21(28)19-13-15-12-16(2-4-18(15)29-19)27-9-7-26(8-10-27)6-5-14-1-3-17-20(11-14)30-22(24)25-17/h1-4,11-13H,5-10H2,(H2,23,28)(H2,24,25).
What are the key properties of 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide?
5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide has a molecular weight of 421.53 g/mol, XLogP of 3.09, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[2-(2-amino-1,3-benzothiazol-6-yl)ethyl]piperazin-1-yl]-1-benzofuran-2-carboxamide is sourced from PubChem (CID 177379740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).