C31H33FN4O4 — CID 177380232
(3S,5S)-1-(2,3-dihydro-1-benzofuran-5-yl)-5-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(4-methoxycyclohexyl)benzimidazol-2-yl]-3-fluoropyrrolidin-2-one (PubChem CID 177380232) has the molecular formula C31H33FN4O4 and a molecular weight of 544.63 g/mol. Its IUPAC name is (3S,5S)-1-(2,3-dihydro-1-benzofuran-5-yl)-5-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(4-methoxycyclohexyl)benzimidazol-2-yl]-3-fluoropyrrolidin-2-one.
| Compound Name | (3S,5S)-1-(2,3-dihydro-1-benzofuran-5-yl)-5-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(4-methoxycyclohexyl)benzimidazol-2-yl]-3-fluoropyrrolidin-2-one |
|---|---|
| PubChem CID | 177380232 |
| Molecular Formula | C31H33FN4O4 |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | (3S,5S)-1-(2,3-dihydro-1-benzofuran-5-yl)-5-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-(4-methoxycyclohexyl)benzimidazol-2-yl]-3-fluoropyrrolidin-2-one |
| SMILES | COC1CCC(n2c([C@@H]3C[C@H](F)C(=O)N3c3ccc4c(c3)CCO4)nc3cc(-c4c(C)noc4C)ccc32)CC1 |
| InChI | InChI=1S/C31H33FN4O4/c1-17-29(18(2)40-34-17)20-4-10-26-25(15-20)33-30(35(26)21-5-8-23(38-3)9-6-21)27-16-24(32)31(37)36(27)22-7-11-28-19(14-22)12-13-39-28/h4,7,10-11,14-15,21,23-24,27H,5-6,8-9,12-13,16H2,1-3H3/t21?,23?,24-,27-/m0/s1 |
| InChIKey | RVVNKKBOWPTVNS-PHJFPFEVSA-N |
| XLogP | 6.19 |
| TPSA | 82.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |