C33H34ClN5O2 — CID 177380811
[4-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl] N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]carbamate (PubChem CID 177380811) has the molecular formula C33H34ClN5O2 and a molecular weight of 568.12 g/mol. Its IUPAC name is [4-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl] N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]carbamate.
| Compound Name | [4-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl] N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 177380811 |
| Molecular Formula | C33H34ClN5O2 |
| Molecular Weight | 568.12 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | [4-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl] N-[6-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]hexyl]carbamate |
| SMILES | O=C(NCCCCCCNc1c2c(nc3cc(Cl)ccc13)CCCC2)Oc1ccc(-c2cc3cccnc3[nH]2)cc1 |
| InChI | InChI=1S/C33H34ClN5O2/c34-24-13-16-27-30(21-24)38-28-10-4-3-9-26(28)31(27)35-17-5-1-2-6-18-37-33(40)41-25-14-11-22(12-15-25)29-20-23-8-7-19-36-32(23)39-29/h7-8,11-16,19-21H,1-6,9-10,17-18H2,(H,35,38)(H,36,39)(H,37,40) |
| InChIKey | GMGARMBFVHCLEI-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.12 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|