C20H15BrN4O5S2 — CID 177381038
5-(bromomethyl)-6-(2,5-dimethoxyphenyl)-3-(4-nitrophenyl)-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 177381038) has the molecular formula C20H15BrN4O5S2 and a molecular weight of 535.40 g/mol. Its IUPAC name is 5-(bromomethyl)-6-(2,5-dimethoxyphenyl)-3-(4-nitrophenyl)-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 5-(bromomethyl)-6-(2,5-dimethoxyphenyl)-3-(4-nitrophenyl)-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 177381038 |
| Molecular Formula | C20H15BrN4O5S2 |
| Molecular Weight | 535.40 g/mol |
| Exact Mass | 533.97 |
| IUPAC Name | 5-(bromomethyl)-6-(2,5-dimethoxyphenyl)-3-(4-nitrophenyl)-2-sulfanylidene-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | COc1ccc(OC)c(-n2c(CBr)nc3c(sc(=S)n3-c3ccc([N+](=O)[O-])cc3)c2=O)c1 |
| InChI | InChI=1S/C20H15BrN4O5S2/c1-29-13-7-8-15(30-2)14(9-13)24-16(10-21)22-18-17(19(24)26)32-20(31)23(18)11-3-5-12(6-4-11)25(27)28/h3-9H,10H2,1-2H3 |
| InChIKey | GLQJDBLPBVEAJX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 101.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|