C27H41F3N4O6 — CID 177381073
methyl N-[(2S)-1-[(3S)-3-[[(3S)-1-(cyclopropylamino)-6,6,6-trifluoro-1,2-dioxohexan-3-yl]carbamoyl]-2-azaspiro[4.5]decan-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate (PubChem CID 177381073) has the molecular formula C27H41F3N4O6 and a molecular weight of 574.64 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(3S)-3-[[(3S)-1-(cyclopropylamino)-6,6,6-trifluoro-1,2-dioxohexan-3-yl]carbamoyl]-2-azaspiro[4.5]decan-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(3S)-3-[[(3S)-1-(cyclopropylamino)-6,6,6-trifluoro-1,2-dioxohexan-3-yl]carbamoyl]-2-azaspiro[4.5]decan-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 177381073 |
| Molecular Formula | C27H41F3N4O6 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | methyl N-[(2S)-1-[(3S)-3-[[(3S)-1-(cyclopropylamino)-6,6,6-trifluoro-1,2-dioxohexan-3-yl]carbamoyl]-2-azaspiro[4.5]decan-2-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CC2(CCCCC2)C[C@H]1C(=O)N[C@@H](CCC(F)(F)F)C(=O)C(=O)NC1CC1)C(C)(C)C |
| InChI | InChI=1S/C27H41F3N4O6/c1-25(2,3)20(33-24(39)40-4)23(38)34-15-26(11-6-5-7-12-26)14-18(34)21(36)32-17(10-13-27(28,29)30)19(35)22(37)31-16-8-9-16/h16-18,20H,5-15H2,1-4H3,(H,31,37)(H,32,36)(H,33,39)/t17-,18-,20+/m0/s1 |
| InChIKey | UXRNXZHMBBPVRF-CMKODMSKSA-N |
| XLogP | 2.98 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|