About 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid
3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid (PubChem CID 177381119) has the molecular formula C16H11N5O2S
and a molecular weight of 337.36 g/mol. Its IUPAC name is 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid.
Molecular Properties
| Compound Name | 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid |
| PubChem CID | 177381119 |
| Molecular Formula | C16H11N5O2S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Nc2nc(-c3cnc4ncccn34)cs2)c1 |
| InChI | InChI=1S/C16H11N5O2S/c22-14(23)10-3-1-4-11(7-10)19-16-20-12(9-24-16)13-8-18-15-17-5-2-6-21(13)15/h1-9H,(H,19,20)(H,22,23) |
| InChIKey | IQYCVUQNOMUIEK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid?
The IUPAC name of 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid (CID 177381119) is 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid.
What is the SMILES notation for 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid?
The canonical SMILES for 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid is O=C(O)c1cccc(Nc2nc(-c3cnc4ncccn34)cs2)c1.
What is the InChIKey of 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid?
The InChIKey is IQYCVUQNOMUIEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N5O2S/c22-14(23)10-3-1-4-11(7-10)19-16-20-12(9-24-16)13-8-18-15-17-5-2-6-21(13)15/h1-9H,(H,19,20)(H,22,23).
What are the key properties of 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid?
3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid has a molecular weight of 337.36 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-imidazo[1,2-a]pyrimidin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid is sourced from PubChem (CID 177381119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).