C32H34ClN7O — CID 177381191
8-(4-aminobutyl)-2-[3-(4-aminophenyl)propylamino]-6-[2-chloro-4-(6-methyl-2-pyridinyl)phenyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 177381191) has the molecular formula C32H34ClN7O and a molecular weight of 568.13 g/mol. Its IUPAC name is 8-(4-aminobutyl)-2-[3-(4-aminophenyl)propylamino]-6-[2-chloro-4-(6-methyl-2-pyridinyl)phenyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(4-aminobutyl)-2-[3-(4-aminophenyl)propylamino]-6-[2-chloro-4-(6-methyl-2-pyridinyl)phenyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 177381191 |
| Molecular Formula | C32H34ClN7O |
| Molecular Weight | 568.13 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | 8-(4-aminobutyl)-2-[3-(4-aminophenyl)propylamino]-6-[2-chloro-4-(6-methyl-2-pyridinyl)phenyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cccc(-c2ccc(-c3cc4cnc(NCCCc5ccc(N)cc5)nc4n(CCCCN)c3=O)c(Cl)c2)n1 |
| InChI | InChI=1S/C32H34ClN7O/c1-21-6-4-8-29(38-21)23-11-14-26(28(33)19-23)27-18-24-20-37-32(36-16-5-7-22-9-12-25(35)13-10-22)39-30(24)40(31(27)41)17-3-2-15-34/h4,6,8-14,18-20H,2-3,5,7,15-17,34-35H2,1H3,(H,36,37,39) |
| InChIKey | ZXUWYRWWPADNPA-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.13 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|