C22H23F3N5OPS — CID 177381345
4-[7-dimethylphosphoryl-5-(trifluoromethyl)-1H-indol-3-yl]-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine (PubChem CID 177381345) has the molecular formula C22H23F3N5OPS and a molecular weight of 493.50 g/mol. Its IUPAC name is 4-[7-dimethylphosphoryl-5-(trifluoromethyl)-1H-indol-3-yl]-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-[7-dimethylphosphoryl-5-(trifluoromethyl)-1H-indol-3-yl]-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 177381345 |
| Molecular Formula | C22H23F3N5OPS |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 4-[7-dimethylphosphoryl-5-(trifluoromethyl)-1H-indol-3-yl]-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine |
| SMILES | CP(C)(=O)c1cc(C(F)(F)F)cc2c(-c3nc(N[C@H]4CCCNC4)nc4ccsc34)c[nH]c12 |
| InChI | InChI=1S/C22H23F3N5OPS/c1-32(2,31)17-9-12(22(23,24)25)8-14-15(11-27-18(14)17)19-20-16(5-7-33-20)29-21(30-19)28-13-4-3-6-26-10-13/h5,7-9,11,13,26-27H,3-4,6,10H2,1-2H3,(H,28,29,30)/t13-/m0/s1 |
| InChIKey | RTWFGLIBDDCVHW-ZDUSSCGKSA-N |
| XLogP | 5.27 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|