C21H23FN5OPS — CID 177381346
4-(7-dimethylphosphoryl-5-fluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine (PubChem CID 177381346) has the molecular formula C21H23FN5OPS and a molecular weight of 443.49 g/mol. Its IUPAC name is 4-(7-dimethylphosphoryl-5-fluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-(7-dimethylphosphoryl-5-fluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 177381346 |
| Molecular Formula | C21H23FN5OPS |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 4-(7-dimethylphosphoryl-5-fluoro-1H-indol-3-yl)-N-[(3S)-piperidin-3-yl]thieno[3,2-d]pyrimidin-2-amine |
| SMILES | CP(C)(=O)c1cc(F)cc2c(-c3nc(N[C@H]4CCCNC4)nc4ccsc34)c[nH]c12 |
| InChI | InChI=1S/C21H23FN5OPS/c1-29(2,28)17-9-12(22)8-14-15(11-24-18(14)17)19-20-16(5-7-30-20)26-21(27-19)25-13-4-3-6-23-10-13/h5,7-9,11,13,23-24H,3-4,6,10H2,1-2H3,(H,25,26,27)/t13-/m0/s1 |
| InChIKey | ROBBURZERULYQU-ZDUSSCGKSA-N |
| XLogP | 4.39 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|