C22H26N5OPS — CID 177381354
4-N-[4-(7-dimethylphosphoryl-1H-indol-3-yl)thieno[3,2-d]pyrimidin-2-yl]cyclohexane-1,4-diamine (PubChem CID 177381354) has the molecular formula C22H26N5OPS and a molecular weight of 439.53 g/mol. Its IUPAC name is 4-N-[4-(7-dimethylphosphoryl-1H-indol-3-yl)thieno[3,2-d]pyrimidin-2-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[4-(7-dimethylphosphoryl-1H-indol-3-yl)thieno[3,2-d]pyrimidin-2-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 177381354 |
| Molecular Formula | C22H26N5OPS |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-N-[4-(7-dimethylphosphoryl-1H-indol-3-yl)thieno[3,2-d]pyrimidin-2-yl]cyclohexane-1,4-diamine |
| SMILES | CP(C)(=O)c1cccc2c(-c3nc(NC4CCC(N)CC4)nc4ccsc34)c[nH]c12 |
| InChI | InChI=1S/C22H26N5OPS/c1-29(2,28)18-5-3-4-15-16(12-24-19(15)18)20-21-17(10-11-30-21)26-22(27-20)25-14-8-6-13(23)7-9-14/h3-5,10-14,24H,6-9,23H2,1-2H3,(H,25,26,27) |
| InChIKey | BUYAXUCATQBEKE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|