C14H21N3 — CID 177381471
(1R,4R,5R)-4-(1H-imidazol-2-yl)-2,2,6-trimethyl-3-azabicyclo[3.3.1]non-6-ene (PubChem CID 177381471) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (1R,4R,5R)-4-(1H-imidazol-2-yl)-2,2,6-trimethyl-3-azabicyclo[3.3.1]non-6-ene.
| Compound Name | (1R,4R,5R)-4-(1H-imidazol-2-yl)-2,2,6-trimethyl-3-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 177381471 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (1R,4R,5R)-4-(1H-imidazol-2-yl)-2,2,6-trimethyl-3-azabicyclo[3.3.1]non-6-ene |
| SMILES | CC1=CC[C@@H]2C[C@H]1[C@H](c1ncc[nH]1)NC2(C)C |
| InChI | InChI=1S/C14H21N3/c1-9-4-5-10-8-11(9)12(17-14(10,2)3)13-15-6-7-16-13/h4,6-7,10-12,17H,5,8H2,1-3H3,(H,15,16)/t10-,11-,12-/m1/s1 |
| InChIKey | YUVLPFRTJOFKLP-IJLUTSLNSA-N |
| XLogP | 2.81 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|