C26H25N3O4S — CID 177381511
2-[(2E)-2-[(E)-(2-hydroxy-6-methyl-3-propan-2-ylphenyl)methylidenehydrazinylidene]-3-naphthalen-1-yl-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 177381511) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-(2-hydroxy-6-methyl-3-propan-2-ylphenyl)methylidenehydrazinylidene]-3-naphthalen-1-yl-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2E)-2-[(E)-(2-hydroxy-6-methyl-3-propan-2-ylphenyl)methylidenehydrazinylidene]-3-naphthalen-1-yl-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 177381511 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 2-[(2E)-2-[(E)-(2-hydroxy-6-methyl-3-propan-2-ylphenyl)methylidenehydrazinylidene]-3-naphthalen-1-yl-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cc1ccc(C(C)C)c(O)c1/C=N/N=C1/SC(CC(=O)O)C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C26H25N3O4S/c1-15(2)18-12-11-16(3)20(24(18)32)14-27-28-26-29(25(33)22(34-26)13-23(30)31)21-10-6-8-17-7-4-5-9-19(17)21/h4-12,14-15,22,32H,13H2,1-3H3,(H,30,31)/b27-14+,28-26+ |
| InChIKey | YFZQQBMUCPICOL-XRVWYUAESA-N |
| XLogP | 5.29 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|