C19H23N5O2S — CID 177381756
N-[2-[3-(2-aminophenyl)-1,2,4-oxadiazol-5-yl]-4-methylthiophen-3-yl]-2-(propylamino)propanamide (PubChem CID 177381756) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[2-[3-(2-aminophenyl)-1,2,4-oxadiazol-5-yl]-4-methylthiophen-3-yl]-2-(propylamino)propanamide.
| Compound Name | N-[2-[3-(2-aminophenyl)-1,2,4-oxadiazol-5-yl]-4-methylthiophen-3-yl]-2-(propylamino)propanamide |
|---|---|
| PubChem CID | 177381756 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[2-[3-(2-aminophenyl)-1,2,4-oxadiazol-5-yl]-4-methylthiophen-3-yl]-2-(propylamino)propanamide |
| SMILES | CCCNC(C)C(=O)Nc1c(C)csc1-c1nc(-c2ccccc2N)no1 |
| InChI | InChI=1S/C19H23N5O2S/c1-4-9-21-12(3)18(25)22-15-11(2)10-27-16(15)19-23-17(24-26-19)13-7-5-6-8-14(13)20/h5-8,10,12,21H,4,9,20H2,1-3H3,(H,22,25) |
| InChIKey | RUEBINIIYPEXAU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|