C14H12N4O — CID 177381757
2-[5-(4-aminophenyl)-1,2,4-oxadiazol-3-yl]aniline (PubChem CID 177381757) has the molecular formula C14H12N4O and a molecular weight of 252.28 g/mol. Its IUPAC name is 2-[5-(4-aminophenyl)-1,2,4-oxadiazol-3-yl]aniline.
| Compound Name | 2-[5-(4-aminophenyl)-1,2,4-oxadiazol-3-yl]aniline |
|---|---|
| PubChem CID | 177381757 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-[5-(4-aminophenyl)-1,2,4-oxadiazol-3-yl]aniline |
| SMILES | Nc1ccc(-c2nc(-c3ccccc3N)no2)cc1 |
| InChI | InChI=1S/C14H12N4O/c15-10-7-5-9(6-8-10)14-17-13(18-19-14)11-3-1-2-4-12(11)16/h1-8H,15-16H2 |
| InChIKey | NGRKMHPVLBNQLV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|