About 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea
1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea (PubChem CID 177381914) has the molecular formula C16H14F2N4O
and a molecular weight of 316.31 g/mol. Its IUPAC name is 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea.
Molecular Properties
| Compound Name | 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea |
| PubChem CID | 177381914 |
| Molecular Formula | C16H14F2N4O |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1n[nH]c2ccc(Cc3cc(F)cc(F)c3)cc12 |
| InChI | InChI=1S/C16H14F2N4O/c1-19-16(23)20-15-13-7-9(2-3-14(13)21-22-15)4-10-5-11(17)8-12(18)6-10/h2-3,5-8H,4H2,1H3,(H3,19,20,21,22,23) |
| InChIKey | VELZIBCSBGEGFC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea?
The IUPAC name of 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea (CID 177381914) is 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea.
What is the SMILES notation for 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea?
The canonical SMILES for 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea is CNC(=O)Nc1n[nH]c2ccc(Cc3cc(F)cc(F)c3)cc12.
What is the InChIKey of 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea?
The InChIKey is VELZIBCSBGEGFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2N4O/c1-19-16(23)20-15-13-7-9(2-3-14(13)21-22-15)4-10-5-11(17)8-12(18)6-10/h2-3,5-8H,4H2,1H3,(H3,19,20,21,22,23).
What are the key properties of 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea?
1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea has a molecular weight of 316.31 g/mol, XLogP of 3.18, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-3-methylurea is sourced from PubChem (CID 177381914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).