About ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate
ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate (PubChem CID 177381915) has the molecular formula C17H15F2N3O2
and a molecular weight of 331.32 g/mol. Its IUPAC name is ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate |
| PubChem CID | 177381915 |
| Molecular Formula | C17H15F2N3O2 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate |
| SMILES | CCOC(=O)Nc1n[nH]c2ccc(Cc3cc(F)cc(F)c3)cc12 |
| InChI | InChI=1S/C17H15F2N3O2/c1-2-24-17(23)20-16-14-8-10(3-4-15(14)21-22-16)5-11-6-12(18)9-13(19)7-11/h3-4,6-9H,2,5H2,1H3,(H2,20,21,22,23) |
| InChIKey | PPBKVTTVRQECPJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate?
The IUPAC name of ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate (CID 177381915) is ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate.
What is the SMILES notation for ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate?
The canonical SMILES for ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate is CCOC(=O)Nc1n[nH]c2ccc(Cc3cc(F)cc(F)c3)cc12.
What is the InChIKey of ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate?
The InChIKey is PPBKVTTVRQECPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N3O2/c1-2-24-17(23)20-16-14-8-10(3-4-15(14)21-22-16)5-11-6-12(18)9-13(19)7-11/h3-4,6-9H,2,5H2,1H3,(H2,20,21,22,23).
What are the key properties of ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate?
ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate has a molecular weight of 331.32 g/mol, XLogP of 4.00, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]carbamate is sourced from PubChem (CID 177381915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).