C15H12N2O5 — CID 177382033
[4-[(E)-3-(2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]phenyl] acetate (PubChem CID 177382033) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is [4-[(E)-3-(2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]phenyl] acetate.
| Compound Name | [4-[(E)-3-(2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 177382033 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [4-[(E)-3-(2,4,6-trioxo-1,3-diazinan-5-ylidene)prop-1-enyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(/C=C/C=C2C(=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C15H12N2O5/c1-9(18)22-11-7-5-10(6-8-11)3-2-4-12-13(19)16-15(21)17-14(12)20/h2-8H,1H3,(H2,16,17,19,20,21)/b3-2+ |
| InChIKey | SMJKLALFWRGOAV-NSCUHMNNSA-N |
| XLogP | 0.92 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|