C34H44ClN3O7 — CID 177382722
ethyl 1-[2-[13-chloro-2-(2,2-dimethylpropyl)-10-(2-methoxyphenyl)-3,5-dioxo-9-oxa-2,6-diazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-6-yl]acetyl]piperidine-3-carboxylate (PubChem CID 177382722) has the molecular formula C34H44ClN3O7 and a molecular weight of 642.19 g/mol. Its IUPAC name is ethyl 1-[2-[13-chloro-2-(2,2-dimethylpropyl)-10-(2-methoxyphenyl)-3,5-dioxo-9-oxa-2,6-diazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-6-yl]acetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-[13-chloro-2-(2,2-dimethylpropyl)-10-(2-methoxyphenyl)-3,5-dioxo-9-oxa-2,6-diazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-6-yl]acetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 177382722 |
| Molecular Formula | C34H44ClN3O7 |
| Molecular Weight | 642.19 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | ethyl 1-[2-[13-chloro-2-(2,2-dimethylpropyl)-10-(2-methoxyphenyl)-3,5-dioxo-9-oxa-2,6-diazabicyclo[9.4.0]pentadeca-1(11),12,14-trien-6-yl]acetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)CN2CCOC(c3ccccc3OC)c3cc(Cl)ccc3N(CC(C)(C)C)C(=O)CC2=O)C1 |
| InChI | InChI=1S/C34H44ClN3O7/c1-6-44-33(42)23-10-9-15-36(20-23)31(41)21-37-16-17-45-32(25-11-7-8-12-28(25)43-5)26-18-24(35)13-14-27(26)38(22-34(2,3)4)30(40)19-29(37)39/h7-8,11-14,18,23,32H,6,9-10,15-17,19-22H2,1-5H3 |
| InChIKey | DLAUNNLIHIBGLC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.19 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|