C26H37N7O — CID 177382856
16-(piperidin-4-ylmethyl)-20-propan-2-yl-10-oxa-2,16,18,22,23,24-hexazatetracyclo[15.6.1.04,9.019,23]tetracosa-1(24),4,6,8,17,19,21-heptaene (PubChem CID 177382856) has the molecular formula C26H37N7O and a molecular weight of 463.63 g/mol. Its IUPAC name is 16-(piperidin-4-ylmethyl)-20-propan-2-yl-10-oxa-2,16,18,22,23,24-hexazatetracyclo[15.6.1.04,9.019,23]tetracosa-1(24),4,6,8,17,19,21-heptaene.
| Compound Name | 16-(piperidin-4-ylmethyl)-20-propan-2-yl-10-oxa-2,16,18,22,23,24-hexazatetracyclo[15.6.1.04,9.019,23]tetracosa-1(24),4,6,8,17,19,21-heptaene |
|---|---|
| PubChem CID | 177382856 |
| Molecular Formula | C26H37N7O |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | 16-(piperidin-4-ylmethyl)-20-propan-2-yl-10-oxa-2,16,18,22,23,24-hexazatetracyclo[15.6.1.04,9.019,23]tetracosa-1(24),4,6,8,17,19,21-heptaene |
| SMILES | CC(C)c1cnn2c3nc(nc12)N(CC1CCNCC1)CCCCCOc1ccccc1CN3 |
| InChI | InChI=1S/C26H37N7O/c1-19(2)22-17-29-33-24(22)30-26-31-25(33)28-16-21-8-4-5-9-23(21)34-15-7-3-6-14-32(26)18-20-10-12-27-13-11-20/h4-5,8-9,17,19-20,27H,3,6-7,10-16,18H2,1-2H3,(H,28,30,31) |
| InChIKey | NRKPJTBUHZKLGS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |