C27H39N7O — CID 177382857
17-(piperidin-4-ylmethyl)-21-propan-2-yl-10-oxa-2,17,19,23,24,25-hexazatetracyclo[16.6.1.04,9.020,24]pentacosa-1(25),4,6,8,18,20,22-heptaene (PubChem CID 177382857) has the molecular formula C27H39N7O and a molecular weight of 477.66 g/mol. Its IUPAC name is 17-(piperidin-4-ylmethyl)-21-propan-2-yl-10-oxa-2,17,19,23,24,25-hexazatetracyclo[16.6.1.04,9.020,24]pentacosa-1(25),4,6,8,18,20,22-heptaene.
| Compound Name | 17-(piperidin-4-ylmethyl)-21-propan-2-yl-10-oxa-2,17,19,23,24,25-hexazatetracyclo[16.6.1.04,9.020,24]pentacosa-1(25),4,6,8,18,20,22-heptaene |
|---|---|
| PubChem CID | 177382857 |
| Molecular Formula | C27H39N7O |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 17-(piperidin-4-ylmethyl)-21-propan-2-yl-10-oxa-2,17,19,23,24,25-hexazatetracyclo[16.6.1.04,9.020,24]pentacosa-1(25),4,6,8,18,20,22-heptaene |
| SMILES | CC(C)c1cnn2c3nc(nc12)N(CC1CCNCC1)CCCCCCOc1ccccc1CN3 |
| InChI | InChI=1S/C27H39N7O/c1-20(2)23-18-30-34-25(23)31-27-32-26(34)29-17-22-9-5-6-10-24(22)35-16-8-4-3-7-15-33(27)19-21-11-13-28-14-12-21/h5-6,9-10,18,20-21,28H,3-4,7-8,11-17,19H2,1-2H3,(H,29,31,32) |
| InChIKey | SCEXYAFUDMYBSF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |