C27H39N7O — CID 177382875
1'-methyl-22-propan-2-ylspiro[10-oxa-2,18,20,24,25,26-hexazatetracyclo[17.6.1.04,9.021,25]hexacosa-1(26),4,6,8,19,21,23-heptaene-16,4'-piperidine] (PubChem CID 177382875) has the molecular formula C27H39N7O and a molecular weight of 477.66 g/mol. Its IUPAC name is 1'-methyl-22-propan-2-ylspiro[10-oxa-2,18,20,24,25,26-hexazatetracyclo[17.6.1.04,9.021,25]hexacosa-1(26),4,6,8,19,21,23-heptaene-16,4'-piperidine].
| Compound Name | 1'-methyl-22-propan-2-ylspiro[10-oxa-2,18,20,24,25,26-hexazatetracyclo[17.6.1.04,9.021,25]hexacosa-1(26),4,6,8,19,21,23-heptaene-16,4'-piperidine] |
|---|---|
| PubChem CID | 177382875 |
| Molecular Formula | C27H39N7O |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 1'-methyl-22-propan-2-ylspiro[10-oxa-2,18,20,24,25,26-hexazatetracyclo[17.6.1.04,9.021,25]hexacosa-1(26),4,6,8,19,21,23-heptaene-16,4'-piperidine] |
| SMILES | CC(C)c1cnn2c3nc(nc12)NCC1(CCCCCOc2ccccc2CN3)CCN(C)CC1 |
| InChI | InChI=1S/C27H39N7O/c1-20(2)22-18-30-34-24(22)31-25-29-19-27(12-14-33(3)15-13-27)11-7-4-8-16-35-23-10-6-5-9-21(23)17-28-26(34)32-25/h5-6,9-10,18,20H,4,7-8,11-17,19H2,1-3H3,(H2,28,29,31,32) |
| InChIKey | IWTCFRYCJSOPDP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |