About 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline
2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline (PubChem CID 177382952) has the molecular formula C22H16ClN5O2
and a molecular weight of 417.86 g/mol. Its IUPAC name is 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline.
Molecular Properties
| Compound Name | 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline |
| PubChem CID | 177382952 |
| Molecular Formula | C22H16ClN5O2 |
| Molecular Weight | 417.86 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline |
| SMILES | COc1cc(OC)cc(-c2ccc3nc(-n4ccc5cnc(Cl)nc54)ncc3c2)c1 |
| InChI | InChI=1S/C22H16ClN5O2/c1-29-17-8-15(9-18(10-17)30-2)13-3-4-19-16(7-13)12-25-22(26-19)28-6-5-14-11-24-21(23)27-20(14)28/h3-12H,1-2H3 |
| InChIKey | MMQMGRGIZFPBSA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.86 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline?
The IUPAC name of 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline (CID 177382952) is 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline.
What is the SMILES notation for 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline?
The canonical SMILES for 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline is COc1cc(OC)cc(-c2ccc3nc(-n4ccc5cnc(Cl)nc54)ncc3c2)c1.
What is the InChIKey of 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline?
The InChIKey is MMQMGRGIZFPBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16ClN5O2/c1-29-17-8-15(9-18(10-17)30-2)13-3-4-19-16(7-13)12-25-22(26-19)28-6-5-14-11-24-21(23)27-20(14)28/h3-12H,1-2H3.
What are the key properties of 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline?
2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline has a molecular weight of 417.86 g/mol, XLogP of 4.70, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloropyrrolo[2,3-d]pyrimidin-7-yl)-6-(3,5-dimethoxyphenyl)quinazoline is sourced from PubChem (CID 177382952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).