C22H23FO4 — CID 177383118
[(3aR,4aR,6R,8aR,9aR)-8a-methyl-3,5-dimethylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-6-yl] 4-fluorobenzoate (PubChem CID 177383118) has the molecular formula C22H23FO4 and a molecular weight of 370.42 g/mol. Its IUPAC name is [(3aR,4aR,6R,8aR,9aR)-8a-methyl-3,5-dimethylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-6-yl] 4-fluorobenzoate.
| Compound Name | [(3aR,4aR,6R,8aR,9aR)-8a-methyl-3,5-dimethylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-6-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 177383118 |
| Molecular Formula | C22H23FO4 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(3aR,4aR,6R,8aR,9aR)-8a-methyl-3,5-dimethylidene-2-oxo-3a,4,4a,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-6-yl] 4-fluorobenzoate |
| SMILES | C=C1C(=O)O[C@@H]2C[C@@]3(C)CC[C@@H](OC(=O)c4ccc(F)cc4)C(=C)[C@@H]3C[C@H]12 |
| InChI | InChI=1S/C22H23FO4/c1-12-16-10-17-13(2)18(26-21(25)14-4-6-15(23)7-5-14)8-9-22(17,3)11-19(16)27-20(12)24/h4-7,16-19H,1-2,8-11H2,3H3/t16-,17+,18-,19-,22-/m1/s1 |
| InChIKey | CAUAYJHHYXBYOG-ZPXGPAEQSA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|