About N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine
N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine (PubChem CID 177383211) has the molecular formula C22H15F2N5
and a molecular weight of 387.39 g/mol. Its IUPAC name is N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine.
Molecular Properties
| Compound Name | N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine |
| PubChem CID | 177383211 |
| Molecular Formula | C22H15F2N5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine |
| SMILES | Fc1cc(F)cc(Cc2ccc3[nH]nc(Nc4ncnc5ccccc45)c3c2)c1 |
| InChI | InChI=1S/C22H15F2N5/c23-15-8-14(9-16(24)11-15)7-13-5-6-20-18(10-13)22(29-28-20)27-21-17-3-1-2-4-19(17)25-12-26-21/h1-6,8-12H,7H2,(H2,25,26,27,28,29) |
| InChIKey | XNDKYUXMARUHPY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine?
The IUPAC name of N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine (CID 177383211) is N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine.
What is the SMILES notation for N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine?
The canonical SMILES for N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine is Fc1cc(F)cc(Cc2ccc3[nH]nc(Nc4ncnc5ccccc45)c3c2)c1.
What is the InChIKey of N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine?
The InChIKey is XNDKYUXMARUHPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F2N5/c23-15-8-14(9-16(24)11-15)7-13-5-6-20-18(10-13)22(29-28-20)27-21-17-3-1-2-4-19(17)25-12-26-21/h1-6,8-12H,7H2,(H2,25,26,27,28,29).
What are the key properties of N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine?
N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine has a molecular weight of 387.39 g/mol, XLogP of 5.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]quinazolin-4-amine is sourced from PubChem (CID 177383211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).