C28H29N3 — CID 177383382
3,6-ditert-butyl-9-quinoxalin-2-ylcarbazole (PubChem CID 177383382) has the molecular formula C28H29N3 and a molecular weight of 407.56 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-quinoxalin-2-ylcarbazole.
| Compound Name | 3,6-ditert-butyl-9-quinoxalin-2-ylcarbazole |
|---|---|
| PubChem CID | 177383382 |
| Molecular Formula | C28H29N3 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 3,6-ditert-butyl-9-quinoxalin-2-ylcarbazole |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cnc2ccccc2n1 |
| InChI | InChI=1S/C28H29N3/c1-27(2,3)18-11-13-24-20(15-18)21-16-19(28(4,5)6)12-14-25(21)31(24)26-17-29-22-9-7-8-10-23(22)30-26/h7-17H,1-6H3 |
| InChIKey | CDBZGXNAPBMBES-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |