C15H28LiNO4 — CID 177383717
lithium 3-[(2-methylpropan-2-yl)oxy]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 177383717) has the molecular formula C15H28LiNO4 and a molecular weight of 293.33 g/mol. Its IUPAC name is lithium 3-[(2-methylpropan-2-yl)oxy]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | lithium 3-[(2-methylpropan-2-yl)oxy]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 177383717 |
| Molecular Formula | C15H28LiNO4 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | lithium 3-[(2-methylpropan-2-yl)oxy]propyl 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OCC[CH-]OC(=O)N1C(C)(C)COC1(C)C.[Li+] |
| InChI | InChI=1S/C15H28NO4.Li/c1-13(2,3)19-10-8-9-18-12(17)16-14(4,5)11-20-15(16,6)7;/h9H,8,10-11H2,1-7H3;/q-1;+1 |
| InChIKey | WXOGZTFHZFBUJT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|