C7H12ClO3P — CID 177383853
[(1Z,3Z)-2-chloro-3-ethylpenta-1,3-dienyl]phosphonic acid (PubChem CID 177383853) has the molecular formula C7H12ClO3P and a molecular weight of 210.60 g/mol. Its IUPAC name is [(1Z,3Z)-2-chloro-3-ethylpenta-1,3-dienyl]phosphonic acid.
| Compound Name | [(1Z,3Z)-2-chloro-3-ethylpenta-1,3-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 177383853 |
| Molecular Formula | C7H12ClO3P |
| Molecular Weight | 210.60 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | [(1Z,3Z)-2-chloro-3-ethylpenta-1,3-dienyl]phosphonic acid |
| SMILES | C/C=C(CC)\C(Cl)=C\P(=O)(O)O |
| InChI | InChI=1S/C7H12ClO3P/c1-3-6(4-2)7(8)5-12(9,10)11/h3,5H,4H2,1-2H3,(H2,9,10,11)/b6-3-,7-5- |
| InChIKey | LBHWDCCPJAMYDB-KKWTZDJOSA-N |
| XLogP | 2.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|