C25H21ClN4O4 — CID 177384003
(5E)-5-[2-(6-chloropurin-7-yl)ethylidene]-3,4-bis(phenylmethoxy)oxolan-2-one (PubChem CID 177384003) has the molecular formula C25H21ClN4O4 and a molecular weight of 476.92 g/mol. Its IUPAC name is (5E)-5-[2-(6-chloropurin-7-yl)ethylidene]-3,4-bis(phenylmethoxy)oxolan-2-one.
| Compound Name | (5E)-5-[2-(6-chloropurin-7-yl)ethylidene]-3,4-bis(phenylmethoxy)oxolan-2-one |
|---|---|
| PubChem CID | 177384003 |
| Molecular Formula | C25H21ClN4O4 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | (5E)-5-[2-(6-chloropurin-7-yl)ethylidene]-3,4-bis(phenylmethoxy)oxolan-2-one |
| SMILES | O=C1O/C(=C/Cn2cnc3ncnc(Cl)c32)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C25H21ClN4O4/c26-23-20-24(28-15-27-23)29-16-30(20)12-11-19-21(32-13-17-7-3-1-4-8-17)22(25(31)34-19)33-14-18-9-5-2-6-10-18/h1-11,15-16,21-22H,12-14H2/b19-11+ |
| InChIKey | NXBYXXICYNHTQK-YBFXNURJSA-N |
| XLogP | 4.09 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |