About 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine
1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine (PubChem CID 177384615) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine.
Molecular Properties
| Compound Name | 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine |
| PubChem CID | 177384615 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine |
| SMILES | COC[C@H](C)/N=C/C1=C=CC=C1 |
| InChI | InChI=1S/C10H13NO/c1-9(8-12-2)11-7-10-5-3-4-6-10/h3-5,7,9H,8H2,1-2H3/b11-7+/t9-/m0/s1 |
| InChIKey | MERRGDDMSGJQET-FKVCUQLRSA-N |
| XLogP | 1.74 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine?
The IUPAC name of 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine (CID 177384615) is 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine.
What is the SMILES notation for 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine?
The canonical SMILES for 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine is COC[C@H](C)/N=C/C1=C=CC=C1.
What is the InChIKey of 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine?
The InChIKey is MERRGDDMSGJQET-FKVCUQLRSA-N. The full InChI is InChI=1S/C10H13NO/c1-9(8-12-2)11-7-10-5-3-4-6-10/h3-5,7,9H,8H2,1-2H3/b11-7+/t9-/m0/s1.
What are the key properties of 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine?
1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine has a molecular weight of 163.22 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-1,2,4-trien-1-yl-N-[(2S)-1-methoxypropan-2-yl]methanimine is sourced from PubChem (CID 177384615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).