C24H50O4Si2 — CID 177384754
(3S,4R,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,5-dimethyl-6-triethylsilyloxynon-8-en-2-one (PubChem CID 177384754) has the molecular formula C24H50O4Si2 and a molecular weight of 458.83 g/mol. Its IUPAC name is (3S,4R,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,5-dimethyl-6-triethylsilyloxynon-8-en-2-one.
| Compound Name | (3S,4R,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,5-dimethyl-6-triethylsilyloxynon-8-en-2-one |
|---|---|
| PubChem CID | 177384754 |
| Molecular Formula | C24H50O4Si2 |
| Molecular Weight | 458.83 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | (3S,4R,5R,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-3,5-dimethyl-6-triethylsilyloxynon-8-en-2-one |
| SMILES | C=C[C@H](OC)[C@H](O[Si](CC)(CC)CC)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(C)=O |
| InChI | InChI=1S/C24H50O4Si2/c1-14-21(26-11)23(28-30(15-2,16-3)17-4)19(6)22(18(5)20(7)25)27-29(12,13)24(8,9)10/h14,18-19,21-23H,1,15-17H2,2-13H3/t18-,19-,21+,22+,23-/m1/s1 |
| InChIKey | WHJLCXQCVNPXSC-VBRDFVIOSA-N |
| XLogP | 6.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.83 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|