C31H30O3 — CID 177384839
(1R,14R,15S,16R)-16-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-15-methyl-20-oxapentacyclo[12.7.0.01,16.02,7.08,13]henicosa-2,4,6,8,10,12-hexaen-21-one (PubChem CID 177384839) has the molecular formula C31H30O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is (1R,14R,15S,16R)-16-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-15-methyl-20-oxapentacyclo[12.7.0.01,16.02,7.08,13]henicosa-2,4,6,8,10,12-hexaen-21-one.
| Compound Name | (1R,14R,15S,16R)-16-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-15-methyl-20-oxapentacyclo[12.7.0.01,16.02,7.08,13]henicosa-2,4,6,8,10,12-hexaen-21-one |
|---|---|
| PubChem CID | 177384839 |
| Molecular Formula | C31H30O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (1R,14R,15S,16R)-16-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-15-methyl-20-oxapentacyclo[12.7.0.01,16.02,7.08,13]henicosa-2,4,6,8,10,12-hexaen-21-one |
| SMILES | COc1ccc(/C=C/C[C@@]23CCCOC(=O)[C@@]24c2ccccc2-c2ccccc2[C@H]4[C@@H]3C)cc1 |
| InChI | InChI=1S/C31H30O3/c1-21-28-26-12-4-3-10-24(26)25-11-5-6-13-27(25)31(28)29(32)34-20-8-19-30(21,31)18-7-9-22-14-16-23(33-2)17-15-22/h3-7,9-17,21,28H,8,18-20H2,1-2H3/b9-7+/t21-,28+,30-,31-/m0/s1 |
| InChIKey | FSXXXKOMJPFHDZ-YSTNPCFWSA-N |
| XLogP | 6.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |