About (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride
(2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride (PubChem CID 177385072) has the molecular formula C8H2Cl2O2S4
and a molecular weight of 329.28 g/mol. Its IUPAC name is (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride.
Molecular Properties
| Compound Name | (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride |
| PubChem CID | 177385072 |
| Molecular Formula | C8H2Cl2O2S4 |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 327.83 |
| IUPAC Name | (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride |
| SMILES | O=C(Cl)C1=CS/C(=C2\SC=C(C(=O)Cl)S2)S1 |
| InChI | InChI=1S/C8H2Cl2O2S4/c9-5(11)3-1-13-7(15-3)8-14-2-4(16-8)6(10)12/h1-2H/b8-7- |
| InChIKey | RPTMFQZEBISROV-FPLPWBNLSA-N |
| XLogP | 4.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride?
The IUPAC name of (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride (CID 177385072) is (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride.
What is the SMILES notation for (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride?
The canonical SMILES for (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride is O=C(Cl)C1=CS/C(=C2\SC=C(C(=O)Cl)S2)S1.
What is the InChIKey of (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride?
The InChIKey is RPTMFQZEBISROV-FPLPWBNLSA-N. The full InChI is InChI=1S/C8H2Cl2O2S4/c9-5(11)3-1-13-7(15-3)8-14-2-4(16-8)6(10)12/h1-2H/b8-7-.
What are the key properties of (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride?
(2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride has a molecular weight of 329.28 g/mol, XLogP of 4.29, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(4-carbonochloridoyl-1,3-dithiol-2-ylidene)-1,3-dithiole-4-carbonyl chloride is sourced from PubChem (CID 177385072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).