C10H8O7 — CID 177386479
(1S,2S,6R,7R)-8,9-dihydroxy-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylic acid (PubChem CID 177386479) has the molecular formula C10H8O7 and a molecular weight of 240.17 g/mol. Its IUPAC name is (1S,2S,6R,7R)-8,9-dihydroxy-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylic acid.
| Compound Name | (1S,2S,6R,7R)-8,9-dihydroxy-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylic acid |
|---|---|
| PubChem CID | 177386479 |
| Molecular Formula | C10H8O7 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | (1S,2S,6R,7R)-8,9-dihydroxy-3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-10-carboxylic acid |
| SMILES | O=C(O)C1[C@H]2C(O)=C(O)[C@@H]1[C@@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C10H8O7/c11-6-1-3(8(13)14)2(7(6)12)5-4(1)9(15)17-10(5)16/h1-5,11-12H,(H,13,14)/t1-,2+,3?,4-,5+ |
| InChIKey | BWYPDZLBYMFWIG-CDTPZGKOSA-N |
| XLogP | -0.41 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|