C28H45FN2O5Si — CID 177386597
methyl (2S)-2-[[(E,2S)-5-[4-[ditert-butyl(fluoro)silyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]amino]propanoate (PubChem CID 177386597) has the molecular formula C28H45FN2O5Si and a molecular weight of 536.76 g/mol. Its IUPAC name is methyl (2S)-2-[[(E,2S)-5-[4-[ditert-butyl(fluoro)silyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[(E,2S)-5-[4-[ditert-butyl(fluoro)silyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 177386597 |
| Molecular Formula | C28H45FN2O5Si |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | methyl (2S)-2-[[(E,2S)-5-[4-[ditert-butyl(fluoro)silyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)[C@H](C/C=C/c1ccc([Si](F)(C(C)(C)C)C(C)(C)C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H45FN2O5Si/c1-19(24(33)35-11)30-23(32)22(31-25(34)36-26(2,3)4)14-12-13-20-15-17-21(18-16-20)37(29,27(5,6)7)28(8,9)10/h12-13,15-19,22H,14H2,1-11H3,(H,30,32)(H,31,34)/b13-12+/t19-,22-/m0/s1 |
| InChIKey | URSRRLCINDRLMD-WXZJWSGTSA-N |
| XLogP | 5.38 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|