C8H8O6 — CID 177386819
(1S,2S,3R,6S,7R,9S)-2-hydroxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid (PubChem CID 177386819) has the molecular formula C8H8O6 and a molecular weight of 200.15 g/mol. Its IUPAC name is (1S,2S,3R,6S,7R,9S)-2-hydroxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid.
| Compound Name | (1S,2S,3R,6S,7R,9S)-2-hydroxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid |
|---|---|
| PubChem CID | 177386819 |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | (1S,2S,3R,6S,7R,9S)-2-hydroxy-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H]2O[C@H]3[C@H](OC(=O)[C@H]31)[C@H]2O |
| InChI | InChI=1S/C8H8O6/c9-3-4-1(7(10)11)2-5(13-4)6(3)14-8(2)12/h1-6,9H,(H,10,11)/t1-,2-,3-,4-,5+,6+/m0/s1 |
| InChIKey | YNHNVIOLMNGKQM-LKPKBOIGSA-N |
| XLogP | -1.63 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |