C20H22N2O2 — CID 177386915
(E)-N-(2-phenylaziridin-1-yl)-1-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methanimine (PubChem CID 177386915) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (E)-N-(2-phenylaziridin-1-yl)-1-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methanimine.
| Compound Name | (E)-N-(2-phenylaziridin-1-yl)-1-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methanimine |
|---|---|
| PubChem CID | 177386915 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (E)-N-(2-phenylaziridin-1-yl)-1-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]methanimine |
| SMILES | C(=N/N1CC1c1ccccc1)\C1(CCc2ccccc2)OCCO1 |
| InChI | InChI=1S/C20H22N2O2/c1-3-7-17(8-4-1)11-12-20(23-13-14-24-20)16-21-22-15-19(22)18-9-5-2-6-10-18/h1-10,16,19H,11-15H2/b21-16+ |
| InChIKey | MDDMFGQZYYVSQD-LTGZKZEYSA-N |
| XLogP | 3.40 |
| TPSA | 33.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|