About 2-(2-azido-2-phenylethyl)-1,4-dioxane
2-(2-azido-2-phenylethyl)-1,4-dioxane (PubChem CID 177387243) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-(2-azido-2-phenylethyl)-1,4-dioxane.
Molecular Properties
| Compound Name | 2-(2-azido-2-phenylethyl)-1,4-dioxane |
| PubChem CID | 177387243 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-(2-azido-2-phenylethyl)-1,4-dioxane |
| SMILES | [N-]=[N+]=NC(CC1COCCO1)c1ccccc1 |
| InChI | InChI=1S/C12H15N3O2/c13-15-14-12(10-4-2-1-3-5-10)8-11-9-16-6-7-17-11/h1-5,11-12H,6-9H2 |
| InChIKey | APYSSTBBDNTSLX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-azido-2-phenylethyl)-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-azido-2-phenylethyl)-1,4-dioxane?
The IUPAC name of 2-(2-azido-2-phenylethyl)-1,4-dioxane (CID 177387243) is 2-(2-azido-2-phenylethyl)-1,4-dioxane.
What is the SMILES notation for 2-(2-azido-2-phenylethyl)-1,4-dioxane?
The canonical SMILES for 2-(2-azido-2-phenylethyl)-1,4-dioxane is [N-]=[N+]=NC(CC1COCCO1)c1ccccc1.
What is the InChIKey of 2-(2-azido-2-phenylethyl)-1,4-dioxane?
The InChIKey is APYSSTBBDNTSLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c13-15-14-12(10-4-2-1-3-5-10)8-11-9-16-6-7-17-11/h1-5,11-12H,6-9H2.
What are the key properties of 2-(2-azido-2-phenylethyl)-1,4-dioxane?
2-(2-azido-2-phenylethyl)-1,4-dioxane has a molecular weight of 233.27 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-azido-2-phenylethyl)-1,4-dioxane is sourced from PubChem (CID 177387243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).