C20H17F3N4O4 — CID 177387428
dimethyl 3-[(Z)-C-cyano-N-[4-(trifluoromethyl)anilino]carbonimidoyl]-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate (PubChem CID 177387428) has the molecular formula C20H17F3N4O4 and a molecular weight of 434.37 g/mol. Its IUPAC name is dimethyl 3-[(Z)-C-cyano-N-[4-(trifluoromethyl)anilino]carbonimidoyl]-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate.
| Compound Name | dimethyl 3-[(Z)-C-cyano-N-[4-(trifluoromethyl)anilino]carbonimidoyl]-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 177387428 |
| Molecular Formula | C20H17F3N4O4 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | dimethyl 3-[(Z)-C-cyano-N-[4-(trifluoromethyl)anilino]carbonimidoyl]-6,7-dihydro-5H-pyrrolizine-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c(/C(C#N)=N/Nc2ccc(C(F)(F)F)cc2)n2c1CCC2 |
| InChI | InChI=1S/C20H17F3N4O4/c1-30-18(28)15-14-4-3-9-27(14)17(16(15)19(29)31-2)13(10-24)26-25-12-7-5-11(6-8-12)20(21,22)23/h5-8,25H,3-4,9H2,1-2H3/b26-13+ |
| InChIKey | QZBQIZRXWKGGKP-LGJNPRDNSA-N |
| XLogP | 3.37 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|