C15H8S6 — CID 177387708
2-[4-(2-cyclopenta-1,2,4-trien-1-ylethynyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine (PubChem CID 177387708) has the molecular formula C15H8S6 and a molecular weight of 380.63 g/mol. Its IUPAC name is 2-[4-(2-cyclopenta-1,2,4-trien-1-ylethynyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine.
| Compound Name | 2-[4-(2-cyclopenta-1,2,4-trien-1-ylethynyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine |
|---|---|
| PubChem CID | 177387708 |
| Molecular Formula | C15H8S6 |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | 2-[4-(2-cyclopenta-1,2,4-trien-1-ylethynyl)-1,3-dithiol-2-ylidene]-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine |
| SMILES | C1=CC=CC=1C#CC1=CSC(=C2SC3=C(SCCS3)S2)S1 |
| InChI | InChI=1S/C15H8S6/c1-2-4-10(3-1)5-6-11-9-18-14(19-11)15-20-12-13(21-15)17-8-7-16-12/h1-3,9H,7-8H2 |
| InChIKey | PRRPDKJOVJXHJZ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|