C32H41NO6 — CID 177388011
[(1R,2R,3E,5R,9E,11R,12S,15R,16S)-12-acetyloxy-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate (PubChem CID 177388011) has the molecular formula C32H41NO6 and a molecular weight of 535.68 g/mol. Its IUPAC name is [(1R,2R,3E,5R,9E,11R,12S,15R,16S)-12-acetyloxy-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate.
| Compound Name | [(1R,2R,3E,5R,9E,11R,12S,15R,16S)-12-acetyloxy-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate |
|---|---|
| PubChem CID | 177388011 |
| Molecular Formula | C32H41NO6 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | [(1R,2R,3E,5R,9E,11R,12S,15R,16S)-12-acetyloxy-16-benzyl-5-hydroxy-5,7,13,14-tetramethyl-18-oxo-17-azatricyclo[9.7.0.01,15]octadeca-3,9,13-trien-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(C)=C(C)[C@H]2[C@H](Cc3ccccc3)NC(=O)[C@]23[C@H](OC(C)=O)/C=C/[C@](C)(O)CC(C)C/C=C/[C@@H]13 |
| InChI | InChI=1S/C32H41NO6/c1-19-11-10-14-25-29(39-23(5)35)21(3)20(2)28-26(17-24-12-8-7-9-13-24)33-30(36)32(25,28)27(38-22(4)34)15-16-31(6,37)18-19/h7-10,12-16,19,25-29,37H,11,17-18H2,1-6H3,(H,33,36)/b14-10+,16-15+/t19?,25-,26-,27+,28-,29+,31-,32+/m0/s1 |
| InChIKey | XBRWGAFKXKEHOK-QQZZWRPBSA-N |
| XLogP | 4.45 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|